About ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate
ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate (PubChem CID 138400010) has the molecular formula C15H30N2O7S
and a molecular weight of 382.48 g/mol. Its IUPAC name is ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate.
Molecular Properties
| Compound Name | ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate |
| PubChem CID | 138400010 |
| Molecular Formula | C15H30N2O7S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CC.CCOS(=O)(=O)O.[H]/N=C(\[O-])C=C |
| InChI | InChI=1S/C10H20NO2.C3H5NO.C2H6O4S/c1-6-11(4,5)7-8-13-10(12)9(2)3;1-2-3(4)5;1-2-6-7(3,4)5/h2,6-8H2,1,3-5H3;2H,1H2,(H2,4,5);2H2,1H3,(H,3,4,5)/q+1;;/p-1 |
| InChIKey | MXBJQVCISYMLBY-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate?
The IUPAC name of ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate (CID 138400010) is ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate.
What is the SMILES notation for ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate?
The canonical SMILES for ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate is C=C(C)C(=O)OCC[N+](C)(C)CC.CCOS(=O)(=O)O.[H]/N=C(\[O-])C=C.
What is the InChIKey of ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate?
The InChIKey is MXBJQVCISYMLBY-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20NO2.C3H5NO.C2H6O4S/c1-6-11(4,5)7-8-13-10(12)9(2)3;1-2-3(4)5;1-2-6-7(3,4)5/h2,6-8H2,1,3-5H3;2H,1H2,(H2,4,5);2H2,1H3,(H,3,4,5)/q+1;;/p-1.
What are the key properties of ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate?
ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate has a molecular weight of 382.48 g/mol, XLogP of 0.54, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;ethyl hydrogen sulfate;prop-2-enimidate is sourced from PubChem (CID 138400010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).