About N,N-dimethylheptan-4-amine;hydrochloride
N,N-dimethylheptan-4-amine;hydrochloride (PubChem CID 138400485) has the molecular formula C9H22ClN
and a molecular weight of 179.74 g/mol. Its IUPAC name is N,N-dimethylheptan-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylheptan-4-amine;hydrochloride |
| PubChem CID | 138400485 |
| Molecular Formula | C9H22ClN |
| Molecular Weight | 179.74 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N,N-dimethylheptan-4-amine;hydrochloride |
| SMILES | CCCC(CCC)N(C)C.Cl |
| InChI | InChI=1S/C9H21N.ClH/c1-5-7-9(8-6-2)10(3)4;/h9H,5-8H2,1-4H3;1H |
| InChIKey | WPPMCGGAMUIMJN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylheptan-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylheptan-4-amine;hydrochloride?
The IUPAC name of N,N-dimethylheptan-4-amine;hydrochloride (CID 138400485) is N,N-dimethylheptan-4-amine;hydrochloride.
What is the SMILES notation for N,N-dimethylheptan-4-amine;hydrochloride?
The canonical SMILES for N,N-dimethylheptan-4-amine;hydrochloride is CCCC(CCC)N(C)C.Cl.
What is the InChIKey of N,N-dimethylheptan-4-amine;hydrochloride?
The InChIKey is WPPMCGGAMUIMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.ClH/c1-5-7-9(8-6-2)10(3)4;/h9H,5-8H2,1-4H3;1H.
What are the key properties of N,N-dimethylheptan-4-amine;hydrochloride?
N,N-dimethylheptan-4-amine;hydrochloride has a molecular weight of 179.74 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylheptan-4-amine;hydrochloride is sourced from PubChem (CID 138400485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).