C15H19Cl2NO — CID 138400673
8-chloro-N,N-dimethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (PubChem CID 138400673) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 8-chloro-N,N-dimethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride.
| Compound Name | 8-chloro-N,N-dimethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
|---|---|
| PubChem CID | 138400673 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 8-chloro-N,N-dimethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| SMILES | C#CCOc1ccc(Cl)c2c1CCCC2N(C)C.Cl |
| InChI | InChI=1S/C15H18ClNO.ClH/c1-4-10-18-14-9-8-12(16)15-11(14)6-5-7-13(15)17(2)3;/h1,8-9,13H,5-7,10H2,2-3H3;1H |
| InChIKey | PWYGSJRLRMOPAG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|