About N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride
N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride (PubChem CID 138400897) has the molecular formula C21H29ClN2O2
and a molecular weight of 376.93 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride |
| PubChem CID | 138400897 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride |
| SMILES | CCOC(C(=O)N(C)CCN(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H28N2O2.ClH/c1-5-25-21(18-12-8-6-9-13-18,19-14-10-7-11-15-19)20(24)23(4)17-16-22(2)3;/h6-15H,5,16-17H2,1-4H3;1H |
| InChIKey | AUYQRZBSZQENLZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride?
The IUPAC name of N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride (CID 138400897) is N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride is CCOC(C(=O)N(C)CCN(C)C)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride?
The InChIKey is AUYQRZBSZQENLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O2.ClH/c1-5-25-21(18-12-8-6-9-13-18,19-14-10-7-11-15-19)20(24)23(4)17-16-22(2)3;/h6-15H,5,16-17H2,1-4H3;1H.
What are the key properties of N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride?
N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride has a molecular weight of 376.93 g/mol, XLogP of 3.41, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-2-ethoxy-N-methyl-2,2-diphenylacetamide;hydrochloride is sourced from PubChem (CID 138400897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).