About 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride
2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride (PubChem CID 138401086) has the molecular formula C13H23Cl2NO2
and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride |
| PubChem CID | 138401086 |
| Molecular Formula | C13H23Cl2NO2 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride |
| SMILES | Cl.ClC1CCCC2(C1)OCC(C1CCCCN1)O2 |
| InChI | InChI=1S/C13H22ClNO2.ClH/c14-10-4-3-6-13(8-10)16-9-12(17-13)11-5-1-2-7-15-11;/h10-12,15H,1-9H2;1H |
| InChIKey | PSMJACOSYPCWOY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The IUPAC name of 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride (CID 138401086) is 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride.
What is the SMILES notation for 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The canonical SMILES for 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride is Cl.ClC1CCCC2(C1)OCC(C1CCCCN1)O2.
What is the InChIKey of 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The InChIKey is PSMJACOSYPCWOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22ClNO2.ClH/c14-10-4-3-6-13(8-10)16-9-12(17-13)11-5-1-2-7-15-11;/h10-12,15H,1-9H2;1H.
What are the key properties of 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride has a molecular weight of 296.24 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloro-1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride is sourced from PubChem (CID 138401086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).