C14H12FNO3S2 — CID 1384013
ethyl 2-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 1384013) has the molecular formula C14H12FNO3S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is ethyl 2-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1384013 |
| Molecular Formula | C14H12FNO3S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | ethyl 2-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=Cc2ccccc2F)SC1=S |
| InChI | InChI=1S/C14H12FNO3S2/c1-2-19-12(17)8-16-13(18)11(21-14(16)20)7-9-5-3-4-6-10(9)15/h3-7H,2,8H2,1H3 |
| InChIKey | JPKZPFYOGVUTJG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|