C22H10BF15O — CID 138401410
diethyloxonio-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 138401410) has the molecular formula C22H10BF15O and a molecular weight of 586.10 g/mol. Its IUPAC name is diethyloxonio-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | diethyloxonio-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 138401410 |
| Molecular Formula | C22H10BF15O |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | diethyloxonio-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC[O+](CC)[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H10BF15O/c1-3-39(4-2)23(5-8(24)14(30)20(36)15(31)9(5)25,6-10(26)16(32)21(37)17(33)11(6)27)7-12(28)18(34)22(38)19(35)13(7)29/h3-4H2,1-2H3 |
| InChIKey | VLTDIZAEUVUPMF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|