About 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride
2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride (PubChem CID 138401573) has the molecular formula C21H27ClN2O2
and a molecular weight of 374.91 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride |
| PubChem CID | 138401573 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C1c2ccccc2N(C)c2ccccc21.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-4-23(5-2)14-15-25-21(24)20-16-10-6-8-12-18(16)22(3)19-13-9-7-11-17(19)20;/h6-13,20H,4-5,14-15H2,1-3H3;1H |
| InChIKey | GUQBDMAZUPCILU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride (CID 138401573) is 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride is CCN(CC)CCOC(=O)C1c2ccccc2N(C)c2ccccc21.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride?
The InChIKey is GUQBDMAZUPCILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2.ClH/c1-4-23(5-2)14-15-25-21(24)20-16-10-6-8-12-18(16)22(3)19-13-9-7-11-17(19)20;/h6-13,20H,4-5,14-15H2,1-3H3;1H.
What are the key properties of 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride?
2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride has a molecular weight of 374.91 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 10-methyl-9H-acridine-9-carboxylate;hydrochloride is sourced from PubChem (CID 138401573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).