About 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide
1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide (PubChem CID 138401712) has the molecular formula C15H19IN2O2
and a molecular weight of 386.23 g/mol. Its IUPAC name is 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide.
Molecular Properties
| Compound Name | 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide |
| PubChem CID | 138401712 |
| Molecular Formula | C15H19IN2O2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide |
| SMILES | CCC/N=C(\[O-])Oc1cccc2ccc(C)[n+](C)c12.I |
| InChI | InChI=1S/C15H18N2O2.HI/c1-4-10-16-15(18)19-13-7-5-6-12-9-8-11(2)17(3)14(12)13;/h5-9H,4,10H2,1-3H3;1H |
| InChIKey | UFQONYJMCBVGEK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide?
The IUPAC name of 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide (CID 138401712) is 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide.
What is the SMILES notation for 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide?
The canonical SMILES for 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide is CCC/N=C(\[O-])Oc1cccc2ccc(C)[n+](C)c12.I.
What is the InChIKey of 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide?
The InChIKey is UFQONYJMCBVGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2.HI/c1-4-10-16-15(18)19-13-7-5-6-12-9-8-11(2)17(3)14(12)13;/h5-9H,4,10H2,1-3H3;1H.
What are the key properties of 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide?
1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide has a molecular weight of 386.23 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dimethylquinolin-1-ium-8-yl)oxy-N-propylmethanimidate;hydroiodide is sourced from PubChem (CID 138401712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).