About 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride
2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride (PubChem CID 138402083) has the molecular formula C13H24ClNO2
and a molecular weight of 261.79 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride |
| PubChem CID | 138402083 |
| Molecular Formula | C13H24ClNO2 |
| Molecular Weight | 261.79 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride |
| SMILES | C1CCC2(CC1)OCC(C1CCCCN1)O2.Cl |
| InChI | InChI=1S/C13H23NO2.ClH/c1-3-7-13(8-4-1)15-10-12(16-13)11-6-2-5-9-14-11;/h11-12,14H,1-10H2;1H |
| InChIKey | AXZOCQIHEMZCGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride (CID 138402083) is 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride.
What is the SMILES notation for 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The canonical SMILES for 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride is C1CCC2(CC1)OCC(C1CCCCN1)O2.Cl.
What is the InChIKey of 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
The InChIKey is AXZOCQIHEMZCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2.ClH/c1-3-7-13(8-4-1)15-10-12(16-13)11-6-2-5-9-14-11;/h11-12,14H,1-10H2;1H.
What are the key properties of 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride?
2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride has a molecular weight of 261.79 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxaspiro[4.5]decan-3-yl)piperidine;hydrochloride is sourced from PubChem (CID 138402083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).