About 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one
2-methyl-1,5-bis(methylsulfanyl)pentan-3-one (PubChem CID 138402890) has the molecular formula C8H16OS2
and a molecular weight of 192.35 g/mol. Its IUPAC name is 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one.
Molecular Properties
| Compound Name | 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one |
| PubChem CID | 138402890 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one |
| SMILES | CSCCC(=O)C(C)CSC |
| InChI | InChI=1S/C8H16OS2/c1-7(6-11-3)8(9)4-5-10-2/h7H,4-6H2,1-3H3 |
| InChIKey | PLCVBHBHAUHKCF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one?
The IUPAC name of 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one (CID 138402890) is 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one.
What is the SMILES notation for 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one?
The canonical SMILES for 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one is CSCCC(=O)C(C)CSC.
What is the InChIKey of 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one?
The InChIKey is PLCVBHBHAUHKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS2/c1-7(6-11-3)8(9)4-5-10-2/h7H,4-6H2,1-3H3.
What are the key properties of 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one?
2-methyl-1,5-bis(methylsulfanyl)pentan-3-one has a molecular weight of 192.35 g/mol, XLogP of 2.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,5-bis(methylsulfanyl)pentan-3-one is sourced from PubChem (CID 138402890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).