About 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one
2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one (PubChem CID 138402904) has the molecular formula C10H20OS3
and a molecular weight of 252.47 g/mol. Its IUPAC name is 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one.
Molecular Properties
| Compound Name | 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one |
| PubChem CID | 138402904 |
| Molecular Formula | C10H20OS3 |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one |
| SMILES | CSCC(C)C(=O)C(CSC)CSC |
| InChI | InChI=1S/C10H20OS3/c1-8(5-12-2)10(11)9(6-13-3)7-14-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | GBQGJKBHHITOQJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one?
The IUPAC name of 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one (CID 138402904) is 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one.
What is the SMILES notation for 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one?
The canonical SMILES for 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one is CSCC(C)C(=O)C(CSC)CSC.
What is the InChIKey of 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one?
The InChIKey is GBQGJKBHHITOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OS3/c1-8(5-12-2)10(11)9(6-13-3)7-14-4/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one?
2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one has a molecular weight of 252.47 g/mol, XLogP of 2.90, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,5-bis(methylsulfanyl)-4-(methylsulfanylmethyl)pentan-3-one is sourced from PubChem (CID 138402904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).