About 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid
2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid (PubChem CID 138402939) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid |
| PubChem CID | 138402939 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid |
| SMILES | CC(C)(C)C(=O)OCc1ccccc1CC(N)C(=O)O |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)14(19)20-9-11-7-5-4-6-10(11)8-12(16)13(17)18/h4-7,12H,8-9,16H2,1-3H3,(H,17,18) |
| InChIKey | WLBGWIHYXGNMNV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid?
The IUPAC name of 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid (CID 138402939) is 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid.
What is the SMILES notation for 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid?
The canonical SMILES for 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid is CC(C)(C)C(=O)OCc1ccccc1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid?
The InChIKey is WLBGWIHYXGNMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-15(2,3)14(19)20-9-11-7-5-4-6-10(11)8-12(16)13(17)18/h4-7,12H,8-9,16H2,1-3H3,(H,17,18).
What are the key properties of 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid?
2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid has a molecular weight of 279.34 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[2-(2,2-dimethylpropanoyloxymethyl)phenyl]propanoic acid is sourced from PubChem (CID 138402939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).