C30H33F4N5O2S — CID 138403237
(3R)-N,N-dimethyl-3-sulfanyl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbutyl]-2-pyridinyl]oxy]ethylamino]butanamide (PubChem CID 138403237) has the molecular formula C30H33F4N5O2S and a molecular weight of 603.69 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-3-sulfanyl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbutyl]-2-pyridinyl]oxy]ethylamino]butanamide.
| Compound Name | (3R)-N,N-dimethyl-3-sulfanyl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbutyl]-2-pyridinyl]oxy]ethylamino]butanamide |
|---|---|
| PubChem CID | 138403237 |
| Molecular Formula | C30H33F4N5O2S |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | (3R)-N,N-dimethyl-3-sulfanyl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbutyl]-2-pyridinyl]oxy]ethylamino]butanamide |
| SMILES | CN(C)C(=O)C[C@@H](S)CNCCOc1ccc(C(c2ccc3n[nH]c(F)c3c2)C(CC(F)(F)F)c2ccccc2)cn1 |
| InChI | InChI=1S/C30H33F4N5O2S/c1-39(2)27(40)15-22(42)18-35-12-13-41-26-11-9-21(17-36-26)28(20-8-10-25-23(14-20)29(31)38-37-25)24(16-30(32,33)34)19-6-4-3-5-7-19/h3-11,14,17,22,24,28,35,42H,12-13,15-16,18H2,1-2H3,(H,37,38)/t22-,24?,28?/m1/s1 |
| InChIKey | ZXTHYWWVHGCBGG-LBOQJQFVSA-N |
| XLogP | 5.71 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|