C30H32F2N6O4S — CID 138403646
5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-13-(3-fluoropropoxy)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 138403646) has the molecular formula C30H32F2N6O4S and a molecular weight of 610.69 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-13-(3-fluoropropoxy)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-13-(3-fluoropropoxy)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 138403646 |
| Molecular Formula | C30H32F2N6O4S |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-13-(3-fluoropropoxy)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3c(OCCCF)ncc(S(C)(=O)=O)c3n([C@H](c3ccccc3F)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C30H32F2N6O4S/c1-18-27(37(2)36-35-18)20-15-23-26(33-16-20)25-29(24(43(3,39)40)17-34-30(25)42-12-6-11-31)38(23)28(19-9-13-41-14-10-19)21-7-4-5-8-22(21)32/h4-5,7-8,15-17,19,28H,6,9-14H2,1-3H3/t28-/m0/s1 |
| InChIKey | JTDRHJOILLBPQN-NDEPHWFRSA-N |
| XLogP | 4.99 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|