C30H30FN9O — CID 138403653
5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-(4-fluorophenyl)-(oxan-4-yl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 138403653) has the molecular formula C30H30FN9O and a molecular weight of 551.63 g/mol. Its IUPAC name is 5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-(4-fluorophenyl)-(oxan-4-yl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-(4-fluorophenyl)-(oxan-4-yl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 138403653 |
| Molecular Formula | C30H30FN9O |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-(4-fluorophenyl)-(oxan-4-yl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3cnc(-c4c(C)nnn4C)cc3n([C@H](c3ccc(F)cc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C30H30FN9O/c1-17-28(38(3)36-34-17)21-13-26-27(33-15-21)23-16-32-24(29-18(2)35-37-39(29)4)14-25(23)40(26)30(20-9-11-41-12-10-20)19-5-7-22(31)8-6-19/h5-8,13-16,20,30H,9-12H2,1-4H3/t30-/m1/s1 |
| InChIKey | QILYLWDHVUVQOL-SSEXGKCCSA-N |
| XLogP | 4.95 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |