C35H47N5O4 — CID 138404055
1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(3-morpholin-4-ylpropoxymethyl)phenyl]indazole-4-carboxamide (PubChem CID 138404055) has the molecular formula C35H47N5O4 and a molecular weight of 601.79 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(3-morpholin-4-ylpropoxymethyl)phenyl]indazole-4-carboxamide.
| Compound Name | 1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(3-morpholin-4-ylpropoxymethyl)phenyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 138404055 |
| Molecular Formula | C35H47N5O4 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | 1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(3-morpholin-4-ylpropoxymethyl)phenyl]indazole-4-carboxamide |
| SMILES | CC1CC(C)C(CNC(=O)c2cc(-c3ccc(COCCCN4CCOCC4)cc3)cc3c2cnn3C2CCCC2)C(=O)N1 |
| InChI | InChI=1S/C35H47N5O4/c1-24-18-25(2)38-35(42)31(24)21-36-34(41)30-19-28(20-33-32(30)22-37-40(33)29-6-3-4-7-29)27-10-8-26(9-11-27)23-44-15-5-12-39-13-16-43-17-14-39/h8-11,19-20,22,24-25,29,31H,3-7,12-18,21,23H2,1-2H3,(H,36,41)(H,38,42) |
| InChIKey | PJBKONSCKGVSJI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|