C34H45N5O4 — CID 138404057
1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(2-morpholin-4-ylethoxymethyl)phenyl]indazole-4-carboxamide (PubChem CID 138404057) has the molecular formula C34H45N5O4 and a molecular weight of 587.77 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(2-morpholin-4-ylethoxymethyl)phenyl]indazole-4-carboxamide.
| Compound Name | 1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(2-morpholin-4-ylethoxymethyl)phenyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 138404057 |
| Molecular Formula | C34H45N5O4 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-6-[4-(2-morpholin-4-ylethoxymethyl)phenyl]indazole-4-carboxamide |
| SMILES | CC1CC(C)C(CNC(=O)c2cc(-c3ccc(COCCN4CCOCC4)cc3)cc3c2cnn3C2CCCC2)C(=O)N1 |
| InChI | InChI=1S/C34H45N5O4/c1-23-17-24(2)37-34(41)30(23)20-35-33(40)29-18-27(19-32-31(29)21-36-39(32)28-5-3-4-6-28)26-9-7-25(8-10-26)22-43-16-13-38-11-14-42-15-12-38/h7-10,18-19,21,23-24,28,30H,3-6,11-17,20,22H2,1-2H3,(H,35,40)(H,37,41) |
| InChIKey | STKWYJUFJZYCJW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|