C30H39N5O3 — CID 138404060
6-[3-(2-aminoethoxymethyl)phenyl]-1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]indazole-4-carboxamide (PubChem CID 138404060) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 6-[3-(2-aminoethoxymethyl)phenyl]-1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]indazole-4-carboxamide.
| Compound Name | 6-[3-(2-aminoethoxymethyl)phenyl]-1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 138404060 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 6-[3-(2-aminoethoxymethyl)phenyl]-1-cyclopentyl-N-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]indazole-4-carboxamide |
| SMILES | CC1CC(C)C(CNC(=O)c2cc(-c3cccc(COCCN)c3)cc3c2cnn3C2CCCC2)C(=O)N1 |
| InChI | InChI=1S/C30H39N5O3/c1-19-12-20(2)34-30(37)26(19)16-32-29(36)25-14-23(22-7-5-6-21(13-22)18-38-11-10-31)15-28-27(25)17-33-35(28)24-8-3-4-9-24/h5-7,13-15,17,19-20,24,26H,3-4,8-12,16,18,31H2,1-2H3,(H,32,36)(H,34,37) |
| InChIKey | NCFVHSDNZJYUTP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|