C24H26FN7 — CID 138404094
7-fluoro-3-[1-(2-methyl-7H-purin-6-yl)pyrrolidin-2-yl]-2-piperidin-1-ylquinoline (PubChem CID 138404094) has the molecular formula C24H26FN7 and a molecular weight of 431.52 g/mol. Its IUPAC name is 7-fluoro-3-[1-(2-methyl-7H-purin-6-yl)pyrrolidin-2-yl]-2-piperidin-1-ylquinoline.
| Compound Name | 7-fluoro-3-[1-(2-methyl-7H-purin-6-yl)pyrrolidin-2-yl]-2-piperidin-1-ylquinoline |
|---|---|
| PubChem CID | 138404094 |
| Molecular Formula | C24H26FN7 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 7-fluoro-3-[1-(2-methyl-7H-purin-6-yl)pyrrolidin-2-yl]-2-piperidin-1-ylquinoline |
| SMILES | Cc1nc(N2CCCC2c2cc3ccc(F)cc3nc2N2CCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C24H26FN7/c1-15-28-22-21(26-14-27-22)24(29-15)32-11-5-6-20(32)18-12-16-7-8-17(25)13-19(16)30-23(18)31-9-3-2-4-10-31/h7-8,12-14,20H,2-6,9-11H2,1H3,(H,26,27,28,29) |
| InChIKey | IXIHVRUYXHPSNP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |