C9H8N6O — CID 138404194
3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 138404194) has the molecular formula C9H8N6O and a molecular weight of 216.20 g/mol. Its IUPAC name is 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 138404194 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1Nc2ccccc2NC1c1nn[nH]n1 |
| InChI | InChI=1S/C9H8N6O/c16-9-7(8-12-14-15-13-8)10-5-3-1-2-4-6(5)11-9/h1-4,7,10H,(H,11,16)(H,12,13,14,15) |
| InChIKey | NZHYJMQNVLIGSC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |