About 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one
3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 138404194) has the molecular formula C9H8N6O
and a molecular weight of 216.20 g/mol. Its IUPAC name is 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 138404194 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1Nc2ccccc2NC1c1nn[nH]n1 |
| InChI | InChI=1S/C9H8N6O/c16-9-7(8-12-14-15-13-8)10-5-3-1-2-4-6(5)11-9/h1-4,7,10H,(H,11,16)(H,12,13,14,15) |
| InChIKey | NZHYJMQNVLIGSC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one (CID 138404194) is 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one is O=C1Nc2ccccc2NC1c1nn[nH]n1.
What is the InChIKey of 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is NZHYJMQNVLIGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6O/c16-9-7(8-12-14-15-13-8)10-5-3-1-2-4-6(5)11-9/h1-4,7,10H,(H,11,16)(H,12,13,14,15).
What are the key properties of 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one?
3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 216.20 g/mol, XLogP of 0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-tetrazol-5-yl)-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 138404194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).