C14H24N4O5 — CID 138404227
(2S)-2-amino-5-[[(2S)-2-aminobutanoyl]-[2-(prop-2-enoylamino)ethyl]amino]-5-oxopentanoic acid (PubChem CID 138404227) has the molecular formula C14H24N4O5 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2S)-2-aminobutanoyl]-[2-(prop-2-enoylamino)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2S)-2-aminobutanoyl]-[2-(prop-2-enoylamino)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138404227 |
| Molecular Formula | C14H24N4O5 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2S)-2-amino-5-[[(2S)-2-aminobutanoyl]-[2-(prop-2-enoylamino)ethyl]amino]-5-oxopentanoic acid |
| SMILES | C=CC(=O)NCCN(C(=O)CC[C@H](N)C(=O)O)C(=O)[C@@H](N)CC |
| InChI | InChI=1S/C14H24N4O5/c1-3-9(15)13(21)18(8-7-17-11(19)4-2)12(20)6-5-10(16)14(22)23/h4,9-10H,2-3,5-8,15-16H2,1H3,(H,17,19)(H,22,23)/t9-,10-/m0/s1 |
| InChIKey | PBXQPJKLKDNJCQ-UWVGGRQHSA-N |
| XLogP | -1.43 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|