C5H5N5O2 — CID 1384053
5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 1384053) has the molecular formula C5H5N5O2 and a molecular weight of 167.13 g/mol. Its IUPAC name is 5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | 5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 1384053 |
| Molecular Formula | C5H5N5O2 |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 5-methoxy-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | COc1nc2nonc2nc1N |
| InChI | InChI=1S/C5H5N5O2/c1-11-5-2(6)7-3-4(8-5)10-12-9-3/h1H3,(H2,6,7,9) |
| InChIKey | HRAFWRRZPYTPED-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |