C22H23N2O3+ — CID 1384103
1-(3-methoxyphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone (PubChem CID 1384103) has the molecular formula C22H23N2O3+ and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone.
| Compound Name | 1-(3-methoxyphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 1384103 |
| Molecular Formula | C22H23N2O3+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone |
| SMILES | COc1ccc(-c2c[n+](CC(=O)c3cccc(OC)c3)c3n2CCC3)cc1 |
| InChI | InChI=1S/C22H23N2O3/c1-26-18-10-8-16(9-11-18)20-14-23(22-7-4-12-24(20)22)15-21(25)17-5-3-6-19(13-17)27-2/h3,5-6,8-11,13-14H,4,7,12,15H2,1-2H3/q+1 |
| InChIKey | CRRAQQWAKKSHDG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|