C20H16F3N3O3 — CID 1384161
1-(3,4-dimethylphenyl)-6-hydroxy-5-[[3-(trifluoromethyl)phenyl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 1384161) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-6-hydroxy-5-[[3-(trifluoromethyl)phenyl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[[3-(trifluoromethyl)phenyl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1384161 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[[3-(trifluoromethyl)phenyl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3cccc(C(F)(F)F)c3)c(=O)[nH]c2=O)cc1C |
| InChI | InChI=1S/C20H16F3N3O3/c1-11-6-7-15(8-12(11)2)26-18(28)16(17(27)25-19(26)29)10-24-14-5-3-4-13(9-14)20(21,22)23/h3-10,28H,1-2H3,(H,25,27,29)/b24-10+ |
| InChIKey | MFLFGKUMMIPIFT-YSURURNPSA-N |
| XLogP | 3.62 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|