C6H4N2O4S2 — CID 1384491
(5R)-5-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 1384491) has the molecular formula C6H4N2O4S2 and a molecular weight of 232.24 g/mol. Its IUPAC name is (5R)-5-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1384491 |
| Molecular Formula | C6H4N2O4S2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | (5R)-5-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H]([C@H]2SC(=O)NC2=O)S1 |
| InChI | InChI=1S/C6H4N2O4S2/c9-3-1(13-5(11)7-3)2-4(10)8-6(12)14-2/h1-2H,(H,7,9,11)(H,8,10,12)/t1-,2+ |
| InChIKey | AZCJABZHQBRNCG-XIXRPRMCSA-N |
| XLogP | -0.31 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|