About 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide
2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide (PubChem CID 1384511) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide |
| PubChem CID | 1384511 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide |
| SMILES | NC(=O)C[C@H]1SC(N)=NC1=O |
| InChI | InChI=1S/C5H7N3O2S/c6-3(9)1-2-4(10)8-5(7)11-2/h2H,1H2,(H2,6,9)(H2,7,8,10)/t2-/m1/s1 |
| InChIKey | AXFONBCPJIDLEZ-UWTATZPHSA-N |
| XLogP | -1.18 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide?
The IUPAC name of 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide (CID 1384511) is 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide.
What is the SMILES notation for 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide?
The canonical SMILES for 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide is NC(=O)C[C@H]1SC(N)=NC1=O.
What is the InChIKey of 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide?
The InChIKey is AXFONBCPJIDLEZ-UWTATZPHSA-N. The full InChI is InChI=1S/C5H7N3O2S/c6-3(9)1-2-4(10)8-5(7)11-2/h2H,1H2,(H2,6,9)(H2,7,8,10)/t2-/m1/s1.
What are the key properties of 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide?
2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide has a molecular weight of 173.20 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]acetamide is sourced from PubChem (CID 1384511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).