C28H35NO — CID 138453479
(3S,5S,8R,9S,10S,13S,14S)-17-isoquinolin-7-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 138453479) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S)-17-isoquinolin-7-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S)-17-isoquinolin-7-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 138453479 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S)-17-isoquinolin-7-yl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3ccc4ccncc4c3)=CC[C@@H]12 |
| InChI | InChI=1S/C28H35NO/c1-27-12-9-22(30)16-21(27)5-6-23-25-8-7-24(28(25,2)13-10-26(23)27)19-4-3-18-11-14-29-17-20(18)15-19/h3-4,7,11,14-15,17,21-23,25-26,30H,5-6,8-10,12-13,16H2,1-2H3/t21-,22-,23-,25-,26-,27-,28+/m0/s1 |
| InChIKey | VJULIXKPYBIXJW-XGIAQDQTSA-N |
| XLogP | 6.63 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |