C16H17N5 — CID 138453615
azaniumylideneazanide;5-azidotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (PubChem CID 138453615) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is azaniumylideneazanide;5-azidotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene.
| Compound Name | azaniumylideneazanide;5-azidotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
|---|---|
| PubChem CID | 138453615 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | azaniumylideneazanide;5-azidotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| SMILES | [N-]=[N+]=Nc1cc2ccc1CCc1ccc(cc1)CC2.[N-]=[NH2+] |
| InChI | InChI=1S/C16H15N3.H2N2/c17-19-18-16-11-14-6-5-12-1-3-13(4-2-12)7-9-15(16)10-8-14;1-2/h1-4,8,10-11H,5-7,9H2;1H2 |
| InChIKey | MDOMTFNYWHWANZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|