C5H7NO3 — CID 138454161
(2R,3R)-2,3-dihydroxy-2,3-dihydro-1H-pyridin-6-one (PubChem CID 138454161) has the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | (2R,3R)-2,3-dihydroxy-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 138454161 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-2,3-dihydro-1H-pyridin-6-one |
| SMILES | O=C1C=C[C@@H](O)[C@@H](O)N1 |
| InChI | InChI=1S/C5H7NO3/c7-3-1-2-4(8)6-5(3)9/h1-3,5,7,9H,(H,6,8)/t3-,5-/m1/s1 |
| InChIKey | IVJMTEBBRJOQHS-NQXXGFSBSA-N |
| XLogP | -1.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |