C14H18N2O6 — CID 138454277
(5S,7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-phenyl-6-oxa-1,3-diazaspiro[4.5]decan-4-one (PubChem CID 138454277) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is (5S,7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-phenyl-6-oxa-1,3-diazaspiro[4.5]decan-4-one.
| Compound Name | (5S,7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-phenyl-6-oxa-1,3-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 138454277 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (5S,7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-phenyl-6-oxa-1,3-diazaspiro[4.5]decan-4-one |
| SMILES | O=C1NC(c2ccccc2)N[C@@]12O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C14H18N2O6/c17-6-8-9(18)10(19)11(20)14(22-8)13(21)15-12(16-14)7-4-2-1-3-5-7/h1-5,8-12,16-20H,6H2,(H,15,21)/t8-,9-,10+,11-,12?,14+/m1/s1 |
| InChIKey | CNCBDKVHQFFXJI-HWHXPSIMSA-N |
| XLogP | -2.43 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |