About 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol
5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol (PubChem CID 138454583) has the molecular formula C22H16N2O3
and a molecular weight of 356.38 g/mol. Its IUPAC name is 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol |
| PubChem CID | 138454583 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol |
| SMILES | Oc1cc(-c2cc(-c3ccccc3)cc(-c3ccccn3)n2)cc(O)c1O |
| InChI | InChI=1S/C22H16N2O3/c25-20-12-16(13-21(26)22(20)27)18-10-15(14-6-2-1-3-7-14)11-19(24-18)17-8-4-5-9-23-17/h1-13,25-27H |
| InChIKey | HNZPITUPKVWANJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol?
The IUPAC name of 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol (CID 138454583) is 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol.
What is the SMILES notation for 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol?
The canonical SMILES for 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol is Oc1cc(-c2cc(-c3ccccc3)cc(-c3ccccn3)n2)cc(O)c1O.
What is the InChIKey of 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol?
The InChIKey is HNZPITUPKVWANJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O3/c25-20-12-16(13-21(26)22(20)27)18-10-15(14-6-2-1-3-7-14)11-19(24-18)17-8-4-5-9-23-17/h1-13,25-27H.
What are the key properties of 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol?
5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol has a molecular weight of 356.38 g/mol, XLogP of 4.59, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-phenyl-6-pyridin-2-yl-2-pyridinyl)benzene-1,2,3-triol is sourced from PubChem (CID 138454583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).