About 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile
6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 138454764) has the molecular formula C13H2F2N4O
and a molecular weight of 268.18 g/mol. Its IUPAC name is 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| PubChem CID | 138454764 |
| Molecular Formula | C13H2F2N4O |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2c(nc1C#N)-c1cc(F)c(F)cc1C2=O |
| InChI | InChI=1S/C13H2F2N4O/c14-7-1-5-6(2-8(7)15)13(20)12-11(5)18-9(3-16)10(4-17)19-12/h1-2H |
| InChIKey | PZUSGRHVYDQLHR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The IUPAC name of 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CID 138454764) is 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile is N#Cc1nc2c(nc1C#N)-c1cc(F)c(F)cc1C2=O.
What is the InChIKey of 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The InChIKey is PZUSGRHVYDQLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H2F2N4O/c14-7-1-5-6(2-8(7)15)13(20)12-11(5)18-9(3-16)10(4-17)19-12/h1-2H.
What are the key properties of 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile has a molecular weight of 268.18 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 138454764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).