C19H26N10O2 — CID 138455891
3-N-[2-[5-[[3-[2-(furan-3-yl)ethyl-methylamino]-1H-1,2,4-triazol-5-yl]amino]furan-3-yl]ethyl]-3-N,4-dimethyl-1,2,4-triazole-3,5-diamine (PubChem CID 138455891) has the molecular formula C19H26N10O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 3-N-[2-[5-[[3-[2-(furan-3-yl)ethyl-methylamino]-1H-1,2,4-triazol-5-yl]amino]furan-3-yl]ethyl]-3-N,4-dimethyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[2-[5-[[3-[2-(furan-3-yl)ethyl-methylamino]-1H-1,2,4-triazol-5-yl]amino]furan-3-yl]ethyl]-3-N,4-dimethyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 138455891 |
| Molecular Formula | C19H26N10O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 3-N-[2-[5-[[3-[2-(furan-3-yl)ethyl-methylamino]-1H-1,2,4-triazol-5-yl]amino]furan-3-yl]ethyl]-3-N,4-dimethyl-1,2,4-triazole-3,5-diamine |
| SMILES | CN(CCc1ccoc1)c1n[nH]c(Nc2cc(CCN(C)c3nnc(N)n3C)co2)n1 |
| InChI | InChI=1S/C19H26N10O2/c1-27(7-4-13-6-9-30-11-13)18-22-17(24-25-18)21-15-10-14(12-31-15)5-8-28(2)19-26-23-16(20)29(19)3/h6,9-12H,4-5,7-8H2,1-3H3,(H2,20,23)(H2,21,22,24,25) |
| InChIKey | NNFFXCVDQKJIMZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |