C19H25N13O — CID 138455937
2-N-[5-[[[4-(dimethylamino)-6-(1H-pyrrol-3-ylamino)-1,3,5-triazin-2-yl]-methylamino]methyl]furan-3-yl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 138455937) has the molecular formula C19H25N13O and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-N-[5-[[[4-(dimethylamino)-6-(1H-pyrrol-3-ylamino)-1,3,5-triazin-2-yl]-methylamino]methyl]furan-3-yl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[5-[[[4-(dimethylamino)-6-(1H-pyrrol-3-ylamino)-1,3,5-triazin-2-yl]-methylamino]methyl]furan-3-yl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 138455937 |
| Molecular Formula | C19H25N13O |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-N-[5-[[[4-(dimethylamino)-6-(1H-pyrrol-3-ylamino)-1,3,5-triazin-2-yl]-methylamino]methyl]furan-3-yl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(Nc2cc[nH]c2)nc(N(C)Cc2cc(N(C)c3nc(N)nc(N)n3)co2)n1 |
| InChI | InChI=1S/C19H25N13O/c1-30(2)17-27-16(23-11-5-6-22-8-11)28-18(29-17)31(3)9-13-7-12(10-33-13)32(4)19-25-14(20)24-15(21)26-19/h5-8,10,22H,9H2,1-4H3,(H,23,27,28,29)(H4,20,21,24,25,26) |
| InChIKey | RKACKXZBVQGXRK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 180.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |