C27H23N2O9P — CID 138456098
2-(4-nitrophenyl)phosphanyl-8-(3,4,5-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one (PubChem CID 138456098) has the molecular formula C27H23N2O9P and a molecular weight of 550.46 g/mol. Its IUPAC name is 2-(4-nitrophenyl)phosphanyl-8-(3,4,5-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one.
| Compound Name | 2-(4-nitrophenyl)phosphanyl-8-(3,4,5-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 138456098 |
| Molecular Formula | C27H23N2O9P |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 2-(4-nitrophenyl)phosphanyl-8-(3,4,5-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
| SMILES | COc1cc(C2C3=C(COC3=O)N(Pc3ccc([N+](=O)[O-])cc3)c3cc4c(cc32)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C27H23N2O9P/c1-33-22-8-14(9-23(34-2)26(22)35-3)24-17-10-20-21(38-13-37-20)11-18(17)28(19-12-36-27(30)25(19)24)39-16-6-4-15(5-7-16)29(31)32/h4-11,24,39H,12-13H2,1-3H3 |
| InChIKey | MDNJJFMQHAAPNW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 118.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|