C10H16N2 — CID 138456145
N-[(1E,3E)-4-(ethylideneamino)-2,3-dimethylbuta-1,3-dienyl]ethanimine (PubChem CID 138456145) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(1E,3E)-4-(ethylideneamino)-2,3-dimethylbuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E,3E)-4-(ethylideneamino)-2,3-dimethylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 138456145 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(1E,3E)-4-(ethylideneamino)-2,3-dimethylbuta-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C(C)/C(C)=C/N=C/C |
| InChI | InChI=1S/C10H16N2/c1-5-11-7-9(3)10(4)8-12-6-2/h5-8H,1-4H3/b9-7+,10-8+,11-5+,12-6+ |
| InChIKey | YNAIRLBAXIHXKY-SKIJPBDLSA-N |
| XLogP | 2.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|