C21H17ClF8N6 — CID 138456766
1-N'-[1-[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]ethenyl]cyclopropane-1,1-diamine (PubChem CID 138456766) has the molecular formula C21H17ClF8N6 and a molecular weight of 540.85 g/mol. Its IUPAC name is 1-N'-[1-[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]ethenyl]cyclopropane-1,1-diamine.
| Compound Name | 1-N'-[1-[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]ethenyl]cyclopropane-1,1-diamine |
|---|---|
| PubChem CID | 138456766 |
| Molecular Formula | C21H17ClF8N6 |
| Molecular Weight | 540.85 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 1-N'-[1-[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]ethenyl]cyclopropane-1,1-diamine |
| SMILES | C=C(NC1(N)CC1)c1cc(-c2cnn(-c3c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn3C)c2)ccc1Cl |
| InChI | InChI=1S/C21H17ClF8N6/c1-10(33-18(31)5-6-18)13-7-11(3-4-14(13)22)12-8-32-36(9-12)17-15(20(25,26)27)16(34-35(17)2)19(23,24)21(28,29)30/h3-4,7-9,33H,1,5-6,31H2,2H3 |
| InChIKey | AIUMQHZGWZZZHE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.85 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|