C22H25N7O3 — CID 138457212
N-[4-amino-2-(4-hydroxypiperidin-1-yl)-5-(methyliminomethyl)phenyl]-2-(2-amino-4-pyridinyl)-1,3-oxazole-4-carboxamide (PubChem CID 138457212) has the molecular formula C22H25N7O3 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[4-amino-2-(4-hydroxypiperidin-1-yl)-5-(methyliminomethyl)phenyl]-2-(2-amino-4-pyridinyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-amino-2-(4-hydroxypiperidin-1-yl)-5-(methyliminomethyl)phenyl]-2-(2-amino-4-pyridinyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 138457212 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[4-amino-2-(4-hydroxypiperidin-1-yl)-5-(methyliminomethyl)phenyl]-2-(2-amino-4-pyridinyl)-1,3-oxazole-4-carboxamide |
| SMILES | C/N=C/c1cc(NC(=O)c2coc(-c3ccnc(N)c3)n2)c(N2CCC(O)CC2)cc1N |
| InChI | InChI=1S/C22H25N7O3/c1-25-11-14-8-17(19(10-16(14)23)29-6-3-15(30)4-7-29)27-21(31)18-12-32-22(28-18)13-2-5-26-20(24)9-13/h2,5,8-12,15,30H,3-4,6-7,23H2,1H3,(H2,24,26)(H,27,31)/b25-11+ |
| InChIKey | DHKIVFSOJLTXBK-OPEKNORGSA-N |
| XLogP | 2.16 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|