C33H45N5O4 — CID 138457293
tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate (PubChem CID 138457293) has the molecular formula C33H45N5O4 and a molecular weight of 575.75 g/mol. Its IUPAC name is tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138457293 |
| Molecular Formula | C33H45N5O4 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]-N-methylcarbamate |
| SMILES | CCCCc1nc2c(NCc3ccc(OC)cc3OC)nc3ccccc3c2n1CCCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H45N5O4/c1-8-9-16-28-36-29-30(38(28)20-13-12-19-37(5)32(39)42-33(2,3)4)25-14-10-11-15-26(25)35-31(29)34-22-23-17-18-24(40-6)21-27(23)41-7/h10-11,14-15,17-18,21H,8-9,12-13,16,19-20,22H2,1-7H3,(H,34,35) |
| InChIKey | KHKPWMCVCPXZPN-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|