C32H43N5O4 — CID 138457295
tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]carbamate (PubChem CID 138457295) has the molecular formula C32H43N5O4 and a molecular weight of 561.73 g/mol. Its IUPAC name is tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 138457295 |
| Molecular Formula | C32H43N5O4 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | tert-butyl N-[4-[2-butyl-4-[(2,4-dimethoxyphenyl)methylamino]imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
| SMILES | CCCCc1nc2c(NCc3ccc(OC)cc3OC)nc3ccccc3c2n1CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H43N5O4/c1-7-8-15-27-36-28-29(37(27)19-12-11-18-33-31(38)41-32(2,3)4)24-13-9-10-14-25(24)35-30(28)34-21-22-16-17-23(39-5)20-26(22)40-6/h9-10,13-14,16-17,20H,7-8,11-12,15,18-19,21H2,1-6H3,(H,33,38)(H,34,35) |
| InChIKey | FEYVYAXXORTGQE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|