C24H23Cl2N3O3 — CID 138457760
N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]phenyl]prop-2-enamide (PubChem CID 138457760) has the molecular formula C24H23Cl2N3O3 and a molecular weight of 472.37 g/mol. Its IUPAC name is N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138457760 |
| Molecular Formula | C24H23Cl2N3O3 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1-c1n[nH]c2c1CCC(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C24H23Cl2N3O3/c1-4-20(30)27-16-8-6-5-7-14(16)24-15-10-9-13(11-17(15)28-29-24)21-22(25)18(31-2)12-19(32-3)23(21)26/h4-8,12-13H,1,9-11H2,2-3H3,(H,27,30)(H,28,29) |
| InChIKey | BWOHOSYCWZTIEA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|