C21H21Cl2N3O2 — CID 138457763
2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]aniline (PubChem CID 138457763) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]aniline.
| Compound Name | 2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]aniline |
|---|---|
| PubChem CID | 138457763 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]aniline |
| SMILES | COc1cc(OC)c(Cl)c(C2CCc3c(-c4ccccc4N)n[nH]c3C2)c1Cl |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-27-16-10-17(28-2)20(23)18(19(16)22)11-7-8-13-15(9-11)25-26-21(13)12-5-3-4-6-14(12)24/h3-6,10-11H,7-9,24H2,1-2H3,(H,25,26) |
| InChIKey | QIMVZWCCLKEFEA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|