C21H20Cl2N4O3 — CID 138457764
N-[2-[3-[(2,6-dichloro-3,5-dimethoxyphenyl)methylamino]-1H-pyrazol-5-yl]phenyl]prop-2-enamide (PubChem CID 138457764) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is N-[2-[3-[(2,6-dichloro-3,5-dimethoxyphenyl)methylamino]-1H-pyrazol-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[3-[(2,6-dichloro-3,5-dimethoxyphenyl)methylamino]-1H-pyrazol-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138457764 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[2-[3-[(2,6-dichloro-3,5-dimethoxyphenyl)methylamino]-1H-pyrazol-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1-c1cc(NCc2c(Cl)c(OC)cc(OC)c2Cl)n[nH]1 |
| InChI | InChI=1S/C21H20Cl2N4O3/c1-4-19(28)25-14-8-6-5-7-12(14)15-9-18(27-26-15)24-11-13-20(22)16(29-2)10-17(30-3)21(13)23/h4-10H,1,11H2,2-3H3,(H,25,28)(H2,24,26,27) |
| InChIKey | LTZVRICLIVYONV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|