C25H46N2O9 — CID 138457788
(Z)-N-methyl-N-[2-[2-[2-[2-[2-[2-[3-(3-methylbutan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-oxobut-2-enamide (PubChem CID 138457788) has the molecular formula C25H46N2O9 and a molecular weight of 518.65 g/mol. Its IUPAC name is (Z)-N-methyl-N-[2-[2-[2-[2-[2-[2-[3-(3-methylbutan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-oxobut-2-enamide.
| Compound Name | (Z)-N-methyl-N-[2-[2-[2-[2-[2-[2-[3-(3-methylbutan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 138457788 |
| Molecular Formula | C25H46N2O9 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (Z)-N-methyl-N-[2-[2-[2-[2-[2-[2-[3-(3-methylbutan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-oxobut-2-enamide |
| SMILES | CC(C)C(C)NC(=O)CCOCCOCCOCCOCCOCCOCCN(C)C(=O)/C=C\C=O |
| InChI | InChI=1S/C25H46N2O9/c1-22(2)23(3)26-24(29)7-10-31-12-14-33-16-18-35-20-21-36-19-17-34-15-13-32-11-8-27(4)25(30)6-5-9-28/h5-6,9,22-23H,7-8,10-21H2,1-4H3,(H,26,29)/b6-5- |
| InChIKey | OBBJWLIHZAADLB-WAYWQWQTSA-N |
| XLogP | 0.85 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|