C25H26Cl2N4O3 — CID 138457812
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]amino]-3-methylphenyl]prop-2-enamide (PubChem CID 138457812) has the molecular formula C25H26Cl2N4O3 and a molecular weight of 501.41 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138457812 |
| Molecular Formula | C25H26Cl2N4O3 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1n[nH]c2c1CCC(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C25H26Cl2N4O3/c1-5-20(32)28-16-8-6-7-13(2)24(16)29-25-15-10-9-14(11-17(15)30-31-25)21-22(26)18(33-3)12-19(34-4)23(21)27/h5-8,12,14H,1,9-11H2,2-4H3,(H,28,32)(H2,29,30,31) |
| InChIKey | GDCIHXPQXMSRIL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|