C28H33Cl2N3O5 — CID 138457996
tert-butyl N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazol-3-yl]carbamate (PubChem CID 138457996) has the molecular formula C28H33Cl2N3O5 and a molecular weight of 562.49 g/mol. Its IUPAC name is tert-butyl N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazol-3-yl]carbamate |
|---|---|
| PubChem CID | 138457996 |
| Molecular Formula | C28H33Cl2N3O5 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | tert-butyl N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydroindazol-3-yl]carbamate |
| SMILES | COc1ccc(Cn2nc(NC(=O)OC(C)(C)C)c3c2CC(c2c(Cl)c(OC)cc(OC)c2Cl)CC3)cc1 |
| InChI | InChI=1S/C28H33Cl2N3O5/c1-28(2,3)38-27(34)31-26-19-12-9-17(23-24(29)21(36-5)14-22(37-6)25(23)30)13-20(19)33(32-26)15-16-7-10-18(35-4)11-8-16/h7-8,10-11,14,17H,9,12-13,15H2,1-6H3,(H,31,32,34) |
| InChIKey | NEARMNVBLSVWKP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |