C30H31F5N6O3S — CID 138458185
N-[2,4-difluoro-3-[1-(2-methyl-1,3-thiazole-4-carbonyl)-3,6-dihydro-2H-pyridin-5-yl]-6-(3,4,5-trimethylpiperazin-1-yl)phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 138458185) has the molecular formula C30H31F5N6O3S and a molecular weight of 650.67 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[1-(2-methyl-1,3-thiazole-4-carbonyl)-3,6-dihydro-2H-pyridin-5-yl]-6-(3,4,5-trimethylpiperazin-1-yl)phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[2,4-difluoro-3-[1-(2-methyl-1,3-thiazole-4-carbonyl)-3,6-dihydro-2H-pyridin-5-yl]-6-(3,4,5-trimethylpiperazin-1-yl)phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138458185 |
| Molecular Formula | C30H31F5N6O3S |
| Molecular Weight | 650.67 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | N-[2,4-difluoro-3-[1-(2-methyl-1,3-thiazole-4-carbonyl)-3,6-dihydro-2H-pyridin-5-yl]-6-(3,4,5-trimethylpiperazin-1-yl)phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1nc(C(=O)N2CCC=C(c3c(F)cc(N4CC(C)N(C)C(C)C4)c(NC(=O)c4c[nH]c(=O)cc4C(F)(F)F)c3F)C2)cs1 |
| InChI | InChI=1S/C30H31F5N6O3S/c1-15-11-41(12-16(2)39(15)4)23-9-21(31)25(18-6-5-7-40(13-18)29(44)22-14-45-17(3)37-22)26(32)27(23)38-28(43)19-10-36-24(42)8-20(19)30(33,34)35/h6,8-10,14-16H,5,7,11-13H2,1-4H3,(H,36,42)(H,38,43) |
| InChIKey | IKXCBBJAOMYFFV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|