C27H12F8 — CID 138458336
6-[2,6-difluoro-4-[(E)-2-(2-fluorophenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138458336) has the molecular formula C27H12F8 and a molecular weight of 488.38 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-[(E)-2-(2-fluorophenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[2,6-difluoro-4-[(E)-2-(2-fluorophenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138458336 |
| Molecular Formula | C27H12F8 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 6-[2,6-difluoro-4-[(E)-2-(2-fluorophenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | Fc1ccccc1/C=C/c1cc(F)c(-c2ccc3c(F)c(C#CC(F)(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C27H12F8/c28-21-4-2-1-3-16(21)6-5-15-11-23(30)25(24(31)12-15)17-7-8-19-18(13-17)14-22(29)20(26(19)32)9-10-27(33,34)35/h1-8,11-14H/b6-5+ |
| InChIKey | AYVATNGMUQGHTI-AATRIKPKSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|