C23H25N5O2 — CID 138458517
6-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]spiro[5,7-dihydro-3H-furo[3,2-f]isoindole-2,1'-cyclobutane]-7-ol (PubChem CID 138458517) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 6-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]spiro[5,7-dihydro-3H-furo[3,2-f]isoindole-2,1'-cyclobutane]-7-ol.
| Compound Name | 6-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]spiro[5,7-dihydro-3H-furo[3,2-f]isoindole-2,1'-cyclobutane]-7-ol |
|---|---|
| PubChem CID | 138458517 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 6-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]spiro[5,7-dihydro-3H-furo[3,2-f]isoindole-2,1'-cyclobutane]-7-ol |
| SMILES | CC(C)n1cnnc1-c1cccc(N2Cc3cc4c(cc3C2O)OC2(CCC2)C4)n1 |
| InChI | InChI=1S/C23H25N5O2/c1-14(2)28-13-24-26-21(28)18-5-3-6-20(25-18)27-12-16-9-15-11-23(7-4-8-23)30-19(15)10-17(16)22(27)29/h3,5-6,9-10,13-14,22,29H,4,7-8,11-12H2,1-2H3 |
| InChIKey | UDCFMHVCCHHPBX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |